C20H22N4O2 — CID 101398608
ethyl 2-methyl-3,4-bis[(4-methylphenyl)imino]diazetidine-1-carboxylate (PubChem CID 101398608) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 2-methyl-3,4-bis[(4-methylphenyl)imino]diazetidine-1-carboxylate.
| Compound Name | ethyl 2-methyl-3,4-bis[(4-methylphenyl)imino]diazetidine-1-carboxylate |
|---|---|
| PubChem CID | 101398608 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | ethyl 2-methyl-3,4-bis[(4-methylphenyl)imino]diazetidine-1-carboxylate |
| SMILES | CCOC(=O)N1C(=N/c2ccc(C)cc2)/C(=N/c2ccc(C)cc2)N1C |
| InChI | InChI=1S/C20H22N4O2/c1-5-26-20(25)24-19(22-17-12-8-15(3)9-13-17)18(23(24)4)21-16-10-6-14(2)7-11-16/h6-13H,5H2,1-4H3/b21-18-,22-19+ |
| InChIKey | RKYJVPYCQIIBBG-JXDXAWHESA-N |
| XLogP | 4.38 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|