C27H34N2O4 — CID 10599672
diethyl 1-butyl-2-(4-methylphenyl)imino-4-phenylpyrrolidine-3,3-dicarboxylate (PubChem CID 10599672) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is diethyl 1-butyl-2-(4-methylphenyl)imino-4-phenylpyrrolidine-3,3-dicarboxylate.
| Compound Name | diethyl 1-butyl-2-(4-methylphenyl)imino-4-phenylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 10599672 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | diethyl 1-butyl-2-(4-methylphenyl)imino-4-phenylpyrrolidine-3,3-dicarboxylate |
| SMILES | CCCCN1CC(c2ccccc2)C(C(=O)OCC)(C(=O)OCC)/C1=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C27H34N2O4/c1-5-8-18-29-19-23(21-12-10-9-11-13-21)27(25(30)32-6-2,26(31)33-7-3)24(29)28-22-16-14-20(4)15-17-22/h9-17,23H,5-8,18-19H2,1-4H3/b28-24- |
| InChIKey | RSQOXYOVJYJLDJ-COOPMVRXSA-N |
| XLogP | 5.04 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|