C26H32N2O4 — CID 10836683
diethyl 1-butyl-4-phenyl-2-phenyliminopyrrolidine-3,3-dicarboxylate (PubChem CID 10836683) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is diethyl 1-butyl-4-phenyl-2-phenyliminopyrrolidine-3,3-dicarboxylate.
| Compound Name | diethyl 1-butyl-4-phenyl-2-phenyliminopyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 10836683 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | diethyl 1-butyl-4-phenyl-2-phenyliminopyrrolidine-3,3-dicarboxylate |
| SMILES | CCCCN1CC(c2ccccc2)C(C(=O)OCC)(C(=O)OCC)/C1=N/c1ccccc1 |
| InChI | InChI=1S/C26H32N2O4/c1-4-7-18-28-19-22(20-14-10-8-11-15-20)26(24(29)31-5-2,25(30)32-6-3)23(28)27-21-16-12-9-13-17-21/h8-17,22H,4-7,18-19H2,1-3H3/b27-23- |
| InChIKey | XVPKFTBBLNDEQH-VYIQYICTSA-N |
| XLogP | 4.73 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|