C35H43FO4 — CID 101399526
[4-[4-(5-prop-2-enoxypentyl)phenyl]phenyl] 3-fluoro-4-[(2S)-octan-2-yl]oxybenzoate (PubChem CID 101399526) has the molecular formula C35H43FO4 and a molecular weight of 546.72 g/mol. Its IUPAC name is [4-[4-(5-prop-2-enoxypentyl)phenyl]phenyl] 3-fluoro-4-[(2S)-octan-2-yl]oxybenzoate.
| Compound Name | [4-[4-(5-prop-2-enoxypentyl)phenyl]phenyl] 3-fluoro-4-[(2S)-octan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 101399526 |
| Molecular Formula | C35H43FO4 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | [4-[4-(5-prop-2-enoxypentyl)phenyl]phenyl] 3-fluoro-4-[(2S)-octan-2-yl]oxybenzoate |
| SMILES | C=CCOCCCCCc1ccc(-c2ccc(OC(=O)c3ccc(O[C@@H](C)CCCCCC)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C35H43FO4/c1-4-6-7-9-12-27(3)39-34-23-20-31(26-33(34)36)35(37)40-32-21-18-30(19-22-32)29-16-14-28(15-17-29)13-10-8-11-25-38-24-5-2/h5,14-23,26-27H,2,4,6-13,24-25H2,1,3H3/t27-/m0/s1 |
| InChIKey | WQFCJAFYRLWBHD-MHZLTWQESA-N |
| XLogP | 9.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|