C34H43FO4 — CID 20609548
[4-(3-fluoro-4-octan-2-yloxyphenyl)phenyl] 4-[2-(methoxymethyl)-2-methylbutyl]benzoate (PubChem CID 20609548) has the molecular formula C34H43FO4 and a molecular weight of 534.71 g/mol. Its IUPAC name is [4-(3-fluoro-4-octan-2-yloxyphenyl)phenyl] 4-[2-(methoxymethyl)-2-methylbutyl]benzoate.
| Compound Name | [4-(3-fluoro-4-octan-2-yloxyphenyl)phenyl] 4-[2-(methoxymethyl)-2-methylbutyl]benzoate |
|---|---|
| PubChem CID | 20609548 |
| Molecular Formula | C34H43FO4 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | [4-(3-fluoro-4-octan-2-yloxyphenyl)phenyl] 4-[2-(methoxymethyl)-2-methylbutyl]benzoate |
| SMILES | CCCCCCC(C)Oc1ccc(-c2ccc(OC(=O)c3ccc(CC(C)(CC)COC)cc3)cc2)cc1F |
| InChI | InChI=1S/C34H43FO4/c1-6-8-9-10-11-25(3)38-32-21-18-29(22-31(32)35)27-16-19-30(20-17-27)39-33(36)28-14-12-26(13-15-28)23-34(4,7-2)24-37-5/h12-22,25H,6-11,23-24H2,1-5H3 |
| InChIKey | VQHZGUODCHTECI-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|