C34H41FO5 — CID 20609536
heptan-4-yl 3-fluoro-4-[4-[4-[2-(methoxymethyl)-2-methylbutyl]phenyl]benzoyl]oxybenzoate (PubChem CID 20609536) has the molecular formula C34H41FO5 and a molecular weight of 548.70 g/mol. Its IUPAC name is heptan-4-yl 3-fluoro-4-[4-[4-[2-(methoxymethyl)-2-methylbutyl]phenyl]benzoyl]oxybenzoate.
| Compound Name | heptan-4-yl 3-fluoro-4-[4-[4-[2-(methoxymethyl)-2-methylbutyl]phenyl]benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 20609536 |
| Molecular Formula | C34H41FO5 |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | heptan-4-yl 3-fluoro-4-[4-[4-[2-(methoxymethyl)-2-methylbutyl]phenyl]benzoyl]oxybenzoate |
| SMILES | CCCC(CCC)OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(CC(C)(CC)COC)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C34H41FO5/c1-6-9-29(10-7-2)39-33(37)28-19-20-31(30(35)21-28)40-32(36)27-17-15-26(16-18-27)25-13-11-24(12-14-25)22-34(4,8-3)23-38-5/h11-21,29H,6-10,22-23H2,1-5H3 |
| InChIKey | OUBCQJTWSDEDEF-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|