C29H36N4O2 — CID 10140213
3-[[2-[(1R)-1-amino-2-(4-phenylmethoxyphenyl)ethyl]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine (PubChem CID 10140213) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-[[2-[(1R)-1-amino-2-(4-phenylmethoxyphenyl)ethyl]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[[2-[(1R)-1-amino-2-(4-phenylmethoxyphenyl)ethyl]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 10140213 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 3-[[2-[(1R)-1-amino-2-(4-phenylmethoxyphenyl)ethyl]-3H-benzimidazol-5-yl]oxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc2nc([C@H](N)Cc3ccc(OCc4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C29H36N4O2/c1-3-33(4-2)17-8-18-34-25-15-16-27-28(20-25)32-29(31-27)26(30)19-22-11-13-24(14-12-22)35-21-23-9-6-5-7-10-23/h5-7,9-16,20,26H,3-4,8,17-19,21,30H2,1-2H3,(H,31,32)/t26-/m1/s1 |
| InChIKey | KDSCZJATQQTGNW-AREMUKBSSA-N |
| XLogP | 5.50 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|