C15H17N3 — CID 101402473
N-butyl-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 101402473) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-butyl-9H-pyrido[3,4-b]indol-3-amine.
| Compound Name | N-butyl-9H-pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 101402473 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-butyl-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | CCCCNc1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C15H17N3/c1-2-3-8-16-15-9-12-11-6-4-5-7-13(11)18-14(12)10-17-15/h4-7,9-10,18H,2-3,8H2,1H3,(H,16,17) |
| InChIKey | CYCGZJGGMSQCSG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|