C17H21NO2 — CID 101403527
(3E,3aR,6aS)-3-(anilinomethylidene)-6,6,6a-trimethyl-4,5-dihydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 101403527) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (3E,3aR,6aS)-3-(anilinomethylidene)-6,6,6a-trimethyl-4,5-dihydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3E,3aR,6aS)-3-(anilinomethylidene)-6,6,6a-trimethyl-4,5-dihydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 101403527 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (3E,3aR,6aS)-3-(anilinomethylidene)-6,6,6a-trimethyl-4,5-dihydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | CC1(C)CC[C@@H]2/C(=C\Nc3ccccc3)C(=O)O[C@@]21C |
| InChI | InChI=1S/C17H21NO2/c1-16(2)10-9-14-13(15(19)20-17(14,16)3)11-18-12-7-5-4-6-8-12/h4-8,11,14,18H,9-10H2,1-3H3/b13-11+/t14-,17+/m1/s1 |
| InChIKey | NGEAKWJZKLRTDU-CSYXYTOGSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|