C19H24N2O2 — CID 163054942
N-[4-[[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methylamino]phenyl]acetamide (PubChem CID 163054942) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[4-[[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methylamino]phenyl]acetamide.
| Compound Name | N-[4-[[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 163054942 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[4-[[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC=C2C(=O)[C@]3(C)CC[C@@H]2C3(C)C)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-12(22)21-14-7-5-13(6-8-14)20-11-15-16-9-10-19(4,17(15)23)18(16,2)3/h5-8,11,16,20H,9-10H2,1-4H3,(H,21,22)/t16-,19-/m0/s1 |
| InChIKey | QDFVPOAUAVQXTQ-LPHOPBHVSA-N |
| XLogP | 3.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|