C22H34N2O4 — CID 101403541
methyl (2S,3S,3aS,7aR)-4-[(2R)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate (PubChem CID 101403541) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (2S,3S,3aS,7aR)-4-[(2R)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate.
| Compound Name | methyl (2S,3S,3aS,7aR)-4-[(2R)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101403541 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | methyl (2S,3S,3aS,7aR)-4-[(2R)-1-(cyclohexylamino)-3-methyl-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
| SMILES | C=C[C@@H]1O[C@@H]2C=CCN([C@@H](C(=O)NC3CCCCC3)C(C)C)[C@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H34N2O4/c1-5-16-18(22(26)27-4)20-17(28-16)12-9-13-24(20)19(14(2)3)21(25)23-15-10-7-6-8-11-15/h5,9,12,14-20H,1,6-8,10-11,13H2,2-4H3,(H,23,25)/t16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | SIJREFNYWWKSTL-OMQSBVIBSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|