C22H32N2O4 — CID 101403544
(2R)-N-cyclohexyl-3-methyl-2-[(1S,2S,7R,9S)-14-oxo-8,13-dioxa-3-azatricyclo[7.5.0.02,7]tetradeca-5,10-dien-3-yl]butanamide (PubChem CID 101403544) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-3-methyl-2-[(1S,2S,7R,9S)-14-oxo-8,13-dioxa-3-azatricyclo[7.5.0.02,7]tetradeca-5,10-dien-3-yl]butanamide.
| Compound Name | (2R)-N-cyclohexyl-3-methyl-2-[(1S,2S,7R,9S)-14-oxo-8,13-dioxa-3-azatricyclo[7.5.0.02,7]tetradeca-5,10-dien-3-yl]butanamide |
|---|---|
| PubChem CID | 101403544 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (2R)-N-cyclohexyl-3-methyl-2-[(1S,2S,7R,9S)-14-oxo-8,13-dioxa-3-azatricyclo[7.5.0.02,7]tetradeca-5,10-dien-3-yl]butanamide |
| SMILES | CC(C)[C@H](C(=O)NC1CCCCC1)N1CC=C[C@H]2O[C@H]3C=CCOC(=O)[C@H]3[C@@H]21 |
| InChI | InChI=1S/C22H32N2O4/c1-14(2)19(21(25)23-15-8-4-3-5-9-15)24-12-6-10-17-20(24)18-16(28-17)11-7-13-27-22(18)26/h6-7,10-11,14-20H,3-5,8-9,12-13H2,1-2H3,(H,23,25)/t16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | BDMCBBUYBDINGA-OMQSBVIBSA-N |
| XLogP | 2.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|