C19H30N2O4 — CID 102342891
methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate (PubChem CID 102342891) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate.
| Compound Name | methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102342891 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-1-oxobutan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
| SMILES | C=C[C@H]1O[C@H]2C=CCN([C@H](CC)C(=O)NC(C)(C)C)[C@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H30N2O4/c1-7-12(17(22)20-19(3,4)5)21-11-9-10-14-16(21)15(18(23)24-6)13(8-2)25-14/h8-10,12-16H,2,7,11H2,1,3-6H3,(H,20,22)/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | UZXXYSRFTSCFHP-IBEHDNSVSA-N |
| XLogP | 1.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|