C23H32N4O5 — CID 101404106
(2S)-2-[(2S,5S)-2-cyclohexyl-5-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanamide (PubChem CID 101404106) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2S)-2-[(2S,5S)-2-cyclohexyl-5-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[(2S,5S)-2-cyclohexyl-5-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 101404106 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (2S)-2-[(2S,5S)-2-cyclohexyl-5-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-3-(4-nitrophenyl)propanamide |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](C2CCCCC2)N([C@@H](Cc2ccc([N+](=O)[O-])cc2)C(N)=O)C1=O |
| InChI | InChI=1S/C23H32N4O5/c1-14(2)12-18-23(30)26(20(22(29)25-18)16-6-4-3-5-7-16)19(21(24)28)13-15-8-10-17(11-9-15)27(31)32/h8-11,14,16,18-20H,3-7,12-13H2,1-2H3,(H2,24,28)(H,25,29)/t18-,19-,20-/m0/s1 |
| InChIKey | HSSQOVHSCUFOMX-UFYCRDLUSA-N |
| XLogP | 2.31 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|