C22H30N4O5 — CID 101404105
(2S)-2-[(2S,5S)-2-cyclohexyl-3,6-dioxo-5-propan-2-ylpiperazin-1-yl]-3-(4-nitrophenyl)propanamide (PubChem CID 101404105) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is (2S)-2-[(2S,5S)-2-cyclohexyl-3,6-dioxo-5-propan-2-ylpiperazin-1-yl]-3-(4-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[(2S,5S)-2-cyclohexyl-3,6-dioxo-5-propan-2-ylpiperazin-1-yl]-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 101404105 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2S)-2-[(2S,5S)-2-cyclohexyl-3,6-dioxo-5-propan-2-ylpiperazin-1-yl]-3-(4-nitrophenyl)propanamide |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](C2CCCCC2)N([C@@H](Cc2ccc([N+](=O)[O-])cc2)C(N)=O)C1=O |
| InChI | InChI=1S/C22H30N4O5/c1-13(2)18-22(29)25(19(21(28)24-18)15-6-4-3-5-7-15)17(20(23)27)12-14-8-10-16(11-9-14)26(30)31/h8-11,13,15,17-19H,3-7,12H2,1-2H3,(H2,23,27)(H,24,28)/t17-,18-,19-/m0/s1 |
| InChIKey | NWKLXPIQODTOBK-FHWLQOOXSA-N |
| XLogP | 1.92 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|