C14H27O5P — CID 101405193
(2-hydroxy-2-oxo-1,2λ5-oxaphospholan-5-yl)methyl decanoate (PubChem CID 101405193) has the molecular formula C14H27O5P and a molecular weight of 306.34 g/mol. Its IUPAC name is (2-hydroxy-2-oxo-1,2λ5-oxaphospholan-5-yl)methyl decanoate.
| Compound Name | (2-hydroxy-2-oxo-1,2λ5-oxaphospholan-5-yl)methyl decanoate |
|---|---|
| PubChem CID | 101405193 |
| Molecular Formula | C14H27O5P |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2-hydroxy-2-oxo-1,2λ5-oxaphospholan-5-yl)methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCC1CCP(=O)(O)O1 |
| InChI | InChI=1S/C14H27O5P/c1-2-3-4-5-6-7-8-9-14(15)18-12-13-10-11-20(16,17)19-13/h13H,2-12H2,1H3,(H,16,17) |
| InChIKey | MBJHYHDTCBGFRO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|