C30H45N3O2 — CID 10140633
4-[[2-benzyl-4-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]butyl]amino]-N-ethylbutanamide (PubChem CID 10140633) has the molecular formula C30H45N3O2 and a molecular weight of 479.71 g/mol. Its IUPAC name is 4-[[2-benzyl-4-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]butyl]amino]-N-ethylbutanamide.
| Compound Name | 4-[[2-benzyl-4-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]butyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 10140633 |
| Molecular Formula | C30H45N3O2 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.35 |
| IUPAC Name | 4-[[2-benzyl-4-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]butyl]amino]-N-ethylbutanamide |
| SMILES | CCNC(=O)CCCNCC(CCN1CCC(C)(c2cccc(O)c2)C(C)C1)Cc1ccccc1 |
| InChI | InChI=1S/C30H45N3O2/c1-4-32-29(35)14-9-17-31-22-26(20-25-10-6-5-7-11-25)15-18-33-19-16-30(3,24(2)23-33)27-12-8-13-28(34)21-27/h5-8,10-13,21,24,26,31,34H,4,9,14-20,22-23H2,1-3H3,(H,32,35) |
| InChIKey | CTZGQDSFFRSQND-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|