C15H13F13O3 — CID 101406587
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-oxocyclohexane-1-carboxylate (PubChem CID 101406587) has the molecular formula C15H13F13O3 and a molecular weight of 488.24 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-oxocyclohexane-1-carboxylate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101406587 |
| Molecular Formula | C15H13F13O3 |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-oxocyclohexane-1-carboxylate |
| SMILES | O=C1CCCCC1C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F13O3/c16-10(17,5-6-31-9(30)7-3-1-2-4-8(7)29)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h7H,1-6H2 |
| InChIKey | RFLMUJFKHPWRPV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|