About [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate
[(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate (PubChem CID 134849878) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate |
| PubChem CID | 134849878 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate |
| SMILES | N#C/C=C/CCOC(=O)C1CCCC1=O |
| InChI | InChI=1S/C11H13NO3/c12-7-2-1-3-8-15-11(14)9-5-4-6-10(9)13/h1-2,9H,3-6,8H2/b2-1+ |
| InChIKey | GSLOKLAZRQNHAL-OWOJBTEDSA-N |
| XLogP | 1.37 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate?
The IUPAC name of [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate (CID 134849878) is [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate.
What is the SMILES notation for [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate?
The canonical SMILES for [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate is N#C/C=C/CCOC(=O)C1CCCC1=O.
What is the InChIKey of [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate?
The InChIKey is GSLOKLAZRQNHAL-OWOJBTEDSA-N. The full InChI is InChI=1S/C11H13NO3/c12-7-2-1-3-8-15-11(14)9-5-4-6-10(9)13/h1-2,9H,3-6,8H2/b2-1+.
What are the key properties of [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate?
[(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 1.37, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-cyanobut-3-enyl] 2-oxocyclopentane-1-carboxylate is sourced from PubChem (CID 134849878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).