C38H34N2O2 — CID 101407341
N-benzyl-N-[1-benzyl-2,3-bis(4-methylphenyl)-4-oxoazetidin-3-yl]benzamide (PubChem CID 101407341) has the molecular formula C38H34N2O2 and a molecular weight of 550.70 g/mol. Its IUPAC name is N-benzyl-N-[1-benzyl-2,3-bis(4-methylphenyl)-4-oxoazetidin-3-yl]benzamide.
| Compound Name | N-benzyl-N-[1-benzyl-2,3-bis(4-methylphenyl)-4-oxoazetidin-3-yl]benzamide |
|---|---|
| PubChem CID | 101407341 |
| Molecular Formula | C38H34N2O2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | N-benzyl-N-[1-benzyl-2,3-bis(4-methylphenyl)-4-oxoazetidin-3-yl]benzamide |
| SMILES | Cc1ccc(C2N(Cc3ccccc3)C(=O)C2(c2ccc(C)cc2)N(Cc2ccccc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H34N2O2/c1-28-18-22-32(23-19-28)35-38(34-24-20-29(2)21-25-34,37(42)39(35)26-30-12-6-3-7-13-30)40(27-31-14-8-4-9-15-31)36(41)33-16-10-5-11-17-33/h3-25,35H,26-27H2,1-2H3 |
| InChIKey | OUNHAFIIJKEFKB-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |