About N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide
N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide (PubChem CID 95989767) has the molecular formula C24H22N2O2
and a molecular weight of 370.45 g/mol. Its IUPAC name is N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide.
Molecular Properties
| Compound Name | N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide |
| PubChem CID | 95989767 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide |
| SMILES | CN1C(=O)[C@](c2ccccc2)(N(C)C(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c1-25-21(18-12-6-3-7-13-18)24(23(25)28,20-16-10-5-11-17-20)26(2)22(27)19-14-8-4-9-15-19/h3-17,21H,1-2H3/t21-,24+/m0/s1 |
| InChIKey | WEAXEKGWIYAFKD-XUZZJYLKSA-N |
| XLogP | 3.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide?
The IUPAC name of N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide (CID 95989767) is N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide.
What is the SMILES notation for N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide?
The canonical SMILES for N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide is CN1C(=O)[C@](c2ccccc2)(N(C)C(=O)c2ccccc2)[C@@H]1c1ccccc1.
What is the InChIKey of N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide?
The InChIKey is WEAXEKGWIYAFKD-XUZZJYLKSA-N. The full InChI is InChI=1S/C24H22N2O2/c1-25-21(18-12-6-3-7-13-18)24(23(25)28,20-16-10-5-11-17-20)26(2)22(27)19-14-8-4-9-15-19/h3-17,21H,1-2H3/t21-,24+/m0/s1.
What are the key properties of N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide?
N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide has a molecular weight of 370.45 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3R,4S)-1-methyl-2-oxo-3,4-diphenylazetidin-3-yl]benzamide is sourced from PubChem (CID 95989767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).