C17H26O2S — CID 101407383
ethyl (E)-3-(2,4-dibutylthiophen-3-yl)prop-2-enoate (PubChem CID 101407383) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is ethyl (E)-3-(2,4-dibutylthiophen-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,4-dibutylthiophen-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 101407383 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | ethyl (E)-3-(2,4-dibutylthiophen-3-yl)prop-2-enoate |
| SMILES | CCCCc1csc(CCCC)c1/C=C/C(=O)OCC |
| InChI | InChI=1S/C17H26O2S/c1-4-7-9-14-13-20-16(10-8-5-2)15(14)11-12-17(18)19-6-3/h11-13H,4-10H2,1-3H3/b12-11+ |
| InChIKey | KZTYBIVBJGFJDS-VAWYXSNFSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|