C19H27BrO2 — CID 177433609
ethyl (E)-3-(4-bromo-2,6-dibutylphenyl)prop-2-enoate (PubChem CID 177433609) has the molecular formula C19H27BrO2 and a molecular weight of 367.33 g/mol. Its IUPAC name is ethyl (E)-3-(4-bromo-2,6-dibutylphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(4-bromo-2,6-dibutylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 177433609 |
| Molecular Formula | C19H27BrO2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ethyl (E)-3-(4-bromo-2,6-dibutylphenyl)prop-2-enoate |
| SMILES | CCCCc1cc(Br)cc(CCCC)c1/C=C/C(=O)OCC |
| InChI | InChI=1S/C19H27BrO2/c1-4-7-9-15-13-17(20)14-16(10-8-5-2)18(15)11-12-19(21)22-6-3/h11-14H,4-10H2,1-3H3/b12-11+ |
| InChIKey | RGLOLPLKVUKMCT-VAWYXSNFSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|