C27H46O2 — CID 101407551
ethyl (2E)-2-(2,5-dioctylcyclohepta-2,4-dien-1-ylidene)acetate (PubChem CID 101407551) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is ethyl (2E)-2-(2,5-dioctylcyclohepta-2,4-dien-1-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(2,5-dioctylcyclohepta-2,4-dien-1-ylidene)acetate |
|---|---|
| PubChem CID | 101407551 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | ethyl (2E)-2-(2,5-dioctylcyclohepta-2,4-dien-1-ylidene)acetate |
| SMILES | CCCCCCCCC1=CC=C(CCCCCCCC)/C(=C/C(=O)OCC)CC1 |
| InChI | InChI=1S/C27H46O2/c1-4-7-9-11-13-15-17-24-19-21-25(18-16-14-12-10-8-5-2)26(22-20-24)23-27(28)29-6-3/h19,21,23H,4-18,20,22H2,1-3H3/b26-23+ |
| InChIKey | SCYPZPJCBMWOTJ-WNAAXNPUSA-N |
| XLogP | 8.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|