C12H20O3 — CID 101407776
(4aS,9aR)-6-(methoxymethyl)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine (PubChem CID 101407776) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (4aS,9aR)-6-(methoxymethyl)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine.
| Compound Name | (4aS,9aR)-6-(methoxymethyl)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine |
|---|---|
| PubChem CID | 101407776 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (4aS,9aR)-6-(methoxymethyl)-4a-methyl-2,3,4,8,9,9a-hexahydropyrano[3,2-b]oxepine |
| SMILES | COCC1=CCC[C@H]2OCCC[C@]2(C)O1 |
| InChI | InChI=1S/C12H20O3/c1-12-7-4-8-14-11(12)6-3-5-10(15-12)9-13-2/h5,11H,3-4,6-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | MBRLUNTUKZGOHY-NEPJUHHUSA-N |
| XLogP | 2.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |