C11H18O2 — CID 102055860
2-cyclohexyl-3-methoxy-2,5-dihydrofuran (PubChem CID 102055860) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-cyclohexyl-3-methoxy-2,5-dihydrofuran.
| Compound Name | 2-cyclohexyl-3-methoxy-2,5-dihydrofuran |
|---|---|
| PubChem CID | 102055860 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-cyclohexyl-3-methoxy-2,5-dihydrofuran |
| SMILES | COC1=CCOC1C1CCCCC1 |
| InChI | InChI=1S/C11H18O2/c1-12-10-7-8-13-11(10)9-5-3-2-4-6-9/h7,9,11H,2-6,8H2,1H3 |
| InChIKey | WBRJNZOXRCTPHQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |