C14H22O3 — CID 102183559
(2-cyclohexyl-5,5-dimethyl-2H-furan-3-yl) acetate (PubChem CID 102183559) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2-cyclohexyl-5,5-dimethyl-2H-furan-3-yl) acetate.
| Compound Name | (2-cyclohexyl-5,5-dimethyl-2H-furan-3-yl) acetate |
|---|---|
| PubChem CID | 102183559 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2-cyclohexyl-5,5-dimethyl-2H-furan-3-yl) acetate |
| SMILES | CC(=O)OC1=CC(C)(C)OC1C1CCCCC1 |
| InChI | InChI=1S/C14H22O3/c1-10(15)16-12-9-14(2,3)17-13(12)11-7-5-4-6-8-11/h9,11,13H,4-8H2,1-3H3 |
| InChIKey | ZPDJQKIEYNJTMY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |