C16H19F2NO3 — CID 101409765
ethyl (1S)-6,6-difluoro-1-(4-methoxyanilino)cyclohex-3-ene-1-carboxylate (PubChem CID 101409765) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is ethyl (1S)-6,6-difluoro-1-(4-methoxyanilino)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S)-6,6-difluoro-1-(4-methoxyanilino)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 101409765 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl (1S)-6,6-difluoro-1-(4-methoxyanilino)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Nc2ccc(OC)cc2)CC=CCC1(F)F |
| InChI | InChI=1S/C16H19F2NO3/c1-3-22-14(20)15(10-4-5-11-16(15,17)18)19-12-6-8-13(21-2)9-7-12/h4-9,19H,3,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | BFXNTMSROWRGDP-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|