C14H19NO5S — CID 63166073
ethyl 3-(4-methoxyanilino)-1,1-dioxothiolane-3-carboxylate (PubChem CID 63166073) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is ethyl 3-(4-methoxyanilino)-1,1-dioxothiolane-3-carboxylate.
| Compound Name | ethyl 3-(4-methoxyanilino)-1,1-dioxothiolane-3-carboxylate |
|---|---|
| PubChem CID | 63166073 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethyl 3-(4-methoxyanilino)-1,1-dioxothiolane-3-carboxylate |
| SMILES | CCOC(=O)C1(Nc2ccc(OC)cc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO5S/c1-3-20-13(16)14(8-9-21(17,18)10-14)15-11-4-6-12(19-2)7-5-11/h4-7,15H,3,8-10H2,1-2H3 |
| InChIKey | IHWRDYWVIGENAE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|