C26H30N2O6 — CID 45071499
diethyl 2,5-bis(4-methoxyanilino)cyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 45071499) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is diethyl 2,5-bis(4-methoxyanilino)cyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis(4-methoxyanilino)cyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 45071499 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | diethyl 2,5-bis(4-methoxyanilino)cyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccc(OC)cc2)CC(C(=O)OCC)=C(Nc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C26H30N2O6/c1-5-33-25(29)21-15-24(28-18-9-13-20(32-4)14-10-18)22(26(30)34-6-2)16-23(21)27-17-7-11-19(31-3)12-8-17/h7-14,27-28H,5-6,15-16H2,1-4H3 |
| InChIKey | NXNNKQAVSJRNOX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |