C30H40N4O4 — CID 21058615
dimethyl 2,5-bis[4-(diethylamino)anilino]cyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 21058615) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is dimethyl 2,5-bis[4-(diethylamino)anilino]cyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis[4-(diethylamino)anilino]cyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21058615 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | dimethyl 2,5-bis[4-(diethylamino)anilino]cyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | CCN(CC)c1ccc(NC2=C(C(=O)OC)CC(Nc3ccc(N(CC)CC)cc3)=C(C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C30H40N4O4/c1-7-33(8-2)23-15-11-21(12-16-23)31-27-19-26(30(36)38-6)28(20-25(27)29(35)37-5)32-22-13-17-24(18-14-22)34(9-3)10-4/h11-18,31-32H,7-10,19-20H2,1-6H3 |
| InChIKey | DFBMVERNLUCNJR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|