C24H20N4O4 — CID 21058660
dimethyl 2-(4-cyanoanilino)-5-(4-isocyanoanilino)cyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 21058660) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is dimethyl 2-(4-cyanoanilino)-5-(4-isocyanoanilino)cyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(4-cyanoanilino)-5-(4-isocyanoanilino)cyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21058660 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | dimethyl 2-(4-cyanoanilino)-5-(4-isocyanoanilino)cyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | [C-]#[N+]c1ccc(NC2=C(C(=O)OC)CC(Nc3ccc(C#N)cc3)=C(C(=O)OC)C2)cc1 |
| InChI | InChI=1S/C24H20N4O4/c1-26-16-8-10-18(11-9-16)28-22-13-19(23(29)31-2)21(12-20(22)24(30)32-3)27-17-6-4-15(14-25)5-7-17/h4-11,27-28H,12-13H2,2-3H3 |
| InChIKey | YTJZNOOIVXEABZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|