About CID 59711145
CID 59711145 (PubChem CID 59711145) has the molecular formula C21H12N4+
and a molecular weight of 320.36 g/mol.
Molecular Properties
| Compound Name | CID 59711145 |
| PubChem CID | 59711145 |
| Molecular Formula | C21H12N4+ |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]c1ccc([N+](c2ccc(C#N)cc2)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C21H12N4/c1-24-18-6-12-21(13-7-18)25(19-8-2-16(14-22)3-9-19)20-10-4-17(15-23)5-11-20/h2-13H/q+1 |
| InChIKey | KEVYZSXVWUUCOD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59711145 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59711145?
The IUPAC name of CID 59711145 (CID 59711145) is not available.
What is the SMILES notation for CID 59711145?
The canonical SMILES for CID 59711145 is [C-]#[N+]c1ccc([N+](c2ccc(C#N)cc2)c2ccc(C#N)cc2)cc1.
What is the InChIKey of CID 59711145?
The InChIKey is KEVYZSXVWUUCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12N4/c1-24-18-6-12-21(13-7-18)25(19-8-2-16(14-22)3-9-19)20-10-4-17(15-23)5-11-20/h2-13H/q+1.
What are the key properties of CID 59711145?
CID 59711145 has a molecular weight of 320.36 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59711145 is sourced from PubChem (CID 59711145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).