C31H30O2Si — CID 101410182
phenoxy-diphenyl-[(1E)-2-(phenylmethoxymethyl)penta-1,4-dienyl]silane (PubChem CID 101410182) has the molecular formula C31H30O2Si and a molecular weight of 462.67 g/mol. Its IUPAC name is phenoxy-diphenyl-[(1E)-2-(phenylmethoxymethyl)penta-1,4-dienyl]silane.
| Compound Name | phenoxy-diphenyl-[(1E)-2-(phenylmethoxymethyl)penta-1,4-dienyl]silane |
|---|---|
| PubChem CID | 101410182 |
| Molecular Formula | C31H30O2Si |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | phenoxy-diphenyl-[(1E)-2-(phenylmethoxymethyl)penta-1,4-dienyl]silane |
| SMILES | C=CC/C(=C\[Si](Oc1ccccc1)(c1ccccc1)c1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C31H30O2Si/c1-2-15-28(25-32-24-27-16-7-3-8-17-27)26-34(30-20-11-5-12-21-30,31-22-13-6-14-23-31)33-29-18-9-4-10-19-29/h2-14,16-23,26H,1,15,24-25H2/b28-26+ |
| InChIKey | ZIRCYAFKIWQLGG-BYCLXTJYSA-N |
| XLogP | 6.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|