C14H18O3 — CID 101410534
7,7-dimethyl-4-propyl-6,8-dihydrochromene-2,5-dione (PubChem CID 101410534) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 7,7-dimethyl-4-propyl-6,8-dihydrochromene-2,5-dione.
| Compound Name | 7,7-dimethyl-4-propyl-6,8-dihydrochromene-2,5-dione |
|---|---|
| PubChem CID | 101410534 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 7,7-dimethyl-4-propyl-6,8-dihydrochromene-2,5-dione |
| SMILES | CCCc1cc(=O)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C14H18O3/c1-4-5-9-6-12(16)17-11-8-14(2,3)7-10(15)13(9)11/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | VVTPDDXYOUFKES-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |