C28H38O5 — CID 166636302
7-hydroxy-8-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropyl)chromene-2,5-dione (PubChem CID 166636302) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 7-hydroxy-8-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropyl)chromene-2,5-dione.
| Compound Name | 7-hydroxy-8-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropyl)chromene-2,5-dione |
|---|---|
| PubChem CID | 166636302 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 7-hydroxy-8-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropyl)chromene-2,5-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)c2c(CC(C)C)cc(=O)oc2C(C(=O)CC(C)C)=C1O |
| InChI | InChI=1S/C28H38O5/c1-16(2)9-11-28(12-10-17(3)4)26(31)23-20(13-18(5)6)15-22(30)33-25(23)24(27(28)32)21(29)14-19(7)8/h9-10,15,18-19,32H,11-14H2,1-8H3 |
| InChIKey | LNNUAWRJTXDEQL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|