C11H26O4Si — CID 101410805
2-[tert-butyl(dimethyl)silyl]peroxy-3-methylbutane-1,3-diol (PubChem CID 101410805) has the molecular formula C11H26O4Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]peroxy-3-methylbutane-1,3-diol.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]peroxy-3-methylbutane-1,3-diol |
|---|---|
| PubChem CID | 101410805 |
| Molecular Formula | C11H26O4Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]peroxy-3-methylbutane-1,3-diol |
| SMILES | CC(C)(O)C(CO)OO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H26O4Si/c1-10(2,3)16(6,7)15-14-9(8-12)11(4,5)13/h9,12-13H,8H2,1-7H3 |
| InChIKey | BRBJBHFOFLSGEB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|