C27H31NO4S2 — CID 101410931
S-[(1S,2R)-2-[benzyl(methylsulfonyl)amino]-1-phenylpropyl] (2S,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate (PubChem CID 101410931) has the molecular formula C27H31NO4S2 and a molecular weight of 497.68 g/mol. Its IUPAC name is S-[(1S,2R)-2-[benzyl(methylsulfonyl)amino]-1-phenylpropyl] (2S,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate.
| Compound Name | S-[(1S,2R)-2-[benzyl(methylsulfonyl)amino]-1-phenylpropyl] (2S,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate |
|---|---|
| PubChem CID | 101410931 |
| Molecular Formula | C27H31NO4S2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | S-[(1S,2R)-2-[benzyl(methylsulfonyl)amino]-1-phenylpropyl] (2S,3R)-3-hydroxy-2-methyl-3-phenylpropanethioate |
| SMILES | C[C@H](C(=O)S[C@@H](c1ccccc1)[C@@H](C)N(Cc1ccccc1)S(C)(=O)=O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C27H31NO4S2/c1-20(25(29)23-15-9-5-10-16-23)27(30)33-26(24-17-11-6-12-18-24)21(2)28(34(3,31)32)19-22-13-7-4-8-14-22/h4-18,20-21,25-26,29H,19H2,1-3H3/t20-,21+,25+,26+/m0/s1 |
| InChIKey | XGUHFLIDCMPVKH-QTXKDHNRSA-N |
| XLogP | 5.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|