C30H35NO3S — CID 10907097
N-benzyl-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-1,2,3,4,5,6,7,8-octahydroanthracene-9-sulfonamide (PubChem CID 10907097) has the molecular formula C30H35NO3S and a molecular weight of 489.68 g/mol. Its IUPAC name is N-benzyl-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-1,2,3,4,5,6,7,8-octahydroanthracene-9-sulfonamide.
| Compound Name | N-benzyl-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-1,2,3,4,5,6,7,8-octahydroanthracene-9-sulfonamide |
|---|---|
| PubChem CID | 10907097 |
| Molecular Formula | C30H35NO3S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-benzyl-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-1,2,3,4,5,6,7,8-octahydroanthracene-9-sulfonamide |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(Cc1ccccc1)S(=O)(=O)c1c2c(cc3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C30H35NO3S/c1-22(29(32)24-14-6-3-7-15-24)31(21-23-12-4-2-5-13-23)35(33,34)30-27-18-10-8-16-25(27)20-26-17-9-11-19-28(26)30/h2-7,12-15,20,22,29,32H,8-11,16-19,21H2,1H3/t22-,29-/m0/s1 |
| InChIKey | ZVNCKHUYTJKCML-ZTOMLWHTSA-N |
| XLogP | 5.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |