C40H54BNO4S — CID 11828448
N-benzyl-N-[(1S,2R)-1-[(Z)-1-dicyclohexylboranyloxyprop-1-enoxy]-1-phenylpropan-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 11828448) has the molecular formula C40H54BNO4S and a molecular weight of 655.75 g/mol. Its IUPAC name is N-benzyl-N-[(1S,2R)-1-[(Z)-1-dicyclohexylboranyloxyprop-1-enoxy]-1-phenylpropan-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(1S,2R)-1-[(Z)-1-dicyclohexylboranyloxyprop-1-enoxy]-1-phenylpropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 11828448 |
| Molecular Formula | C40H54BNO4S |
| Molecular Weight | 655.75 g/mol |
| Exact Mass | 655.39 |
| IUPAC Name | N-benzyl-N-[(1S,2R)-1-[(Z)-1-dicyclohexylboranyloxyprop-1-enoxy]-1-phenylpropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | C/C=C(/OB(C1CCCCC1)C1CCCCC1)O[C@@H](c1ccccc1)[C@@H](C)N(Cc1ccccc1)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C40H54BNO4S/c1-6-38(46-41(36-23-15-9-16-24-36)37-25-17-10-18-26-37)45-39(35-21-13-8-14-22-35)33(5)42(29-34-19-11-7-12-20-34)47(43,44)40-31(3)27-30(2)28-32(40)4/h6-8,11-14,19-22,27-28,33,36-37,39H,9-10,15-18,23-26,29H2,1-5H3/b38-6+/t33-,39-/m1/s1 |
| InChIKey | TYMRNOZQBTVMSU-BPQVRHQVSA-N |
| XLogP | 10.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.75 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|