C42H49NO6S — CID 11285462
[(1R,2S)-2-[benzyl-(2,4,6-trimethylphenyl)sulfonylamino]-1-phenylpropyl] (2R)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]hepta-5,6-dienoate (PubChem CID 11285462) has the molecular formula C42H49NO6S and a molecular weight of 695.92 g/mol. Its IUPAC name is [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenyl)sulfonylamino]-1-phenylpropyl] (2R)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]hepta-5,6-dienoate.
| Compound Name | [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenyl)sulfonylamino]-1-phenylpropyl] (2R)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]hepta-5,6-dienoate |
|---|---|
| PubChem CID | 11285462 |
| Molecular Formula | C42H49NO6S |
| Molecular Weight | 695.92 g/mol |
| Exact Mass | 695.33 |
| IUPAC Name | [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenyl)sulfonylamino]-1-phenylpropyl] (2R)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]hepta-5,6-dienoate |
| SMILES | C=C=CCC[C@@H](C(=O)O[C@H](c1ccccc1)[C@H](C)N(Cc1ccccc1)S(=O)(=O)c1c(C)cc(C)cc1C)[C@H](O)CCOCc1ccccc1 |
| InChI | InChI=1S/C42H49NO6S/c1-6-7-11-24-38(39(44)25-26-48-30-36-20-14-9-15-21-36)42(45)49-40(37-22-16-10-17-23-37)34(5)43(29-35-18-12-8-13-19-35)50(46,47)41-32(3)27-31(2)28-33(41)4/h7-10,12-23,27-28,34,38-40,44H,1,11,24-26,29-30H2,2-5H3/t34-,38+,39+,40-/m0/s1 |
| InChIKey | ICYJLTRZIZBJNW-CRAYSMOQSA-N |
| XLogP | 8.18 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.92 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|