C32H42O7S — CID 101256988
[(2R,3S,4R,6R)-2,3-dihydroxy-6-methyl-4,8-bis(phenylmethoxy)octyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 101256988) has the molecular formula C32H42O7S and a molecular weight of 570.75 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-2,3-dihydroxy-6-methyl-4,8-bis(phenylmethoxy)octyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,6R)-2,3-dihydroxy-6-methyl-4,8-bis(phenylmethoxy)octyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 101256988 |
| Molecular Formula | C32H42O7S |
| Molecular Weight | 570.75 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | [(2R,3S,4R,6R)-2,3-dihydroxy-6-methyl-4,8-bis(phenylmethoxy)octyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)OC[C@@H](O)[C@H](O)[C@@H](C[C@H](C)CCOCc2ccccc2)OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C32H42O7S/c1-23(15-16-37-20-27-11-7-5-8-12-27)19-30(38-21-28-13-9-6-10-14-28)31(34)29(33)22-39-40(35,36)32-25(3)17-24(2)18-26(32)4/h5-14,17-18,23,29-31,33-34H,15-16,19-22H2,1-4H3/t23-,29-,30-,31+/m1/s1 |
| InChIKey | HWXSGDKJYMYUSC-UEHSUQEWSA-N |
| XLogP | 5.26 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|