C32H39NO5S — CID 134904503
[(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (E,2R,3R)-3-hydroxy-2-methylhex-4-enoate (PubChem CID 134904503) has the molecular formula C32H39NO5S and a molecular weight of 549.73 g/mol. Its IUPAC name is [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (E,2R,3R)-3-hydroxy-2-methylhex-4-enoate.
| Compound Name | [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (E,2R,3R)-3-hydroxy-2-methylhex-4-enoate |
|---|---|
| PubChem CID | 134904503 |
| Molecular Formula | C32H39NO5S |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (E,2R,3R)-3-hydroxy-2-methylhex-4-enoate |
| SMILES | C/C=C/[C@@H](O)[C@@H](C)C(=O)O[C@H](c1ccccc1)[C@H](C)N(Cc1ccccc1)S(=O)Oc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C32H39NO5S/c1-7-14-29(34)25(5)32(35)37-31(28-17-12-9-13-18-28)26(6)33(21-27-15-10-8-11-16-27)39(36)38-30-23(3)19-22(2)20-24(30)4/h7-20,25-26,29,31,34H,21H2,1-6H3/b14-7+/t25-,26+,29-,31+,39?/m1/s1 |
| InChIKey | LRHBTRFYRIVJCK-VTAFTESISA-N |
| XLogP | 6.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|