C32H41NO5S — CID 134904413
[(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (2R,3R)-3-hydroxy-2,4-dimethylpentanoate (PubChem CID 134904413) has the molecular formula C32H41NO5S and a molecular weight of 551.75 g/mol. Its IUPAC name is [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (2R,3R)-3-hydroxy-2,4-dimethylpentanoate.
| Compound Name | [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (2R,3R)-3-hydroxy-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 134904413 |
| Molecular Formula | C32H41NO5S |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | [(1R,2S)-2-[benzyl-(2,4,6-trimethylphenoxy)sulfinylamino]-1-phenylpropyl] (2R,3R)-3-hydroxy-2,4-dimethylpentanoate |
| SMILES | Cc1cc(C)c(OS(=O)N(Cc2ccccc2)[C@@H](C)[C@H](OC(=O)[C@H](C)[C@H](O)C(C)C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C32H41NO5S/c1-21(2)29(34)25(6)32(35)37-31(28-16-12-9-13-17-28)26(7)33(20-27-14-10-8-11-15-27)39(36)38-30-23(4)18-22(3)19-24(30)5/h8-19,21,25-26,29,31,34H,20H2,1-7H3/t25-,26+,29-,31+,39?/m1/s1 |
| InChIKey | ZMMOCRDFTVLKSX-WVIGHTBZSA-N |
| XLogP | 6.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |