C34H43NO3 — CID 177494577
[(1R,2S)-2-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-1-phenylpropyl] (E,2R,3S)-3-hydroxy-2-methylhex-4-enoate (PubChem CID 177494577) has the molecular formula C34H43NO3 and a molecular weight of 513.72 g/mol. Its IUPAC name is [(1R,2S)-2-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-1-phenylpropyl] (E,2R,3S)-3-hydroxy-2-methylhex-4-enoate.
| Compound Name | [(1R,2S)-2-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-1-phenylpropyl] (E,2R,3S)-3-hydroxy-2-methylhex-4-enoate |
|---|---|
| PubChem CID | 177494577 |
| Molecular Formula | C34H43NO3 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | [(1R,2S)-2-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-1-phenylpropyl] (E,2R,3S)-3-hydroxy-2-methylhex-4-enoate |
| SMILES | C/C=C/[C@H](O)[C@@H](C)C(=O)O[C@H](c1ccccc1)[C@H](C)N(Cc1ccccc1C)Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C34H43NO3/c1-8-14-32(36)27(6)34(37)38-33(29-16-10-9-11-17-29)28(7)35(21-30-18-13-12-15-24(30)3)22-31-25(4)19-23(2)20-26(31)5/h8-20,27-28,32-33,36H,21-22H2,1-7H3/b14-8+/t27-,28+,32+,33+/m1/s1 |
| InChIKey | FONVXJPKUIOBSE-LTLZDNBDSA-N |
| XLogP | 7.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|