C29H34ClNO2 — CID 150708247
(2R,3S)-2-chloro-4-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-3-phenylpentanoic acid (PubChem CID 150708247) has the molecular formula C29H34ClNO2 and a molecular weight of 464.05 g/mol. Its IUPAC name is (2R,3S)-2-chloro-4-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-3-phenylpentanoic acid.
| Compound Name | (2R,3S)-2-chloro-4-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 150708247 |
| Molecular Formula | C29H34ClNO2 |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (2R,3S)-2-chloro-4-[(2-methylphenyl)methyl-[(2,4,6-trimethylphenyl)methyl]amino]-3-phenylpentanoic acid |
| SMILES | Cc1cc(C)c(CN(Cc2ccccc2C)C(C)[C@H](c2ccccc2)[C@@H](Cl)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C29H34ClNO2/c1-19-15-21(3)26(22(4)16-19)18-31(17-25-14-10-9-11-20(25)2)23(5)27(28(30)29(32)33)24-12-7-6-8-13-24/h6-16,23,27-28H,17-18H2,1-5H3,(H,32,33)/t23?,27-,28-/m1/s1 |
| InChIKey | JNHYHVFJFBZIDK-QSFNAEDHSA-N |
| XLogP | 6.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|