C20H25NO7S2 — CID 101126541
[(1R,2S)-2-[benzyl(methylsulfonylsulfonyl)amino]-1-phenylpropyl] 2-methoxyacetate (PubChem CID 101126541) has the molecular formula C20H25NO7S2 and a molecular weight of 455.55 g/mol. Its IUPAC name is [(1R,2S)-2-[benzyl(methylsulfonylsulfonyl)amino]-1-phenylpropyl] 2-methoxyacetate.
| Compound Name | [(1R,2S)-2-[benzyl(methylsulfonylsulfonyl)amino]-1-phenylpropyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 101126541 |
| Molecular Formula | C20H25NO7S2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [(1R,2S)-2-[benzyl(methylsulfonylsulfonyl)amino]-1-phenylpropyl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@H](c1ccccc1)[C@H](C)N(Cc1ccccc1)S(=O)(=O)S(C)(=O)=O |
| InChI | InChI=1S/C20H25NO7S2/c1-16(20(28-19(22)15-27-2)18-12-8-5-9-13-18)21(30(25,26)29(3,23)24)14-17-10-6-4-7-11-17/h4-13,16,20H,14-15H2,1-3H3/t16-,20-/m0/s1 |
| InChIKey | OGNCSSRMDWNRFT-JXFKEZNVSA-N |
| XLogP | 2.10 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|