C40H50N4O2 — CID 101411208
CID 101411208 (PubChem CID 101411208) has the molecular formula C40H50N4O2 and a molecular weight of 618.87 g/mol.
| Compound Name | CID 101411208 |
|---|---|
| PubChem CID | 101411208 |
| Molecular Formula | C40H50N4O2 |
| Molecular Weight | 618.87 g/mol |
| Exact Mass | 618.39 |
| IUPAC Name | — |
| SMILES | CCOC(=O)Cc1cc2[nH]c1C1(CCCC1)c1ccc([nH]1)C1(CCCC1)c1ccc([nH]1)C1(CCCC1)c1ccc([nH]1)C21CCCC1 |
| InChI | InChI=1S/C40H50N4O2/c1-2-46-35(45)26-27-25-34-39(21-7-8-22-39)32-14-13-30(42-32)37(17-3-4-18-37)28-11-12-29(41-28)38(19-5-6-20-38)31-15-16-33(43-31)40(36(27)44-34)23-9-10-24-40/h11-16,25,41-44H,2-10,17-24,26H2,1H3 |
| InChIKey | FSQHHZLPJBGWLB-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.87 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |