C19H26O4 — CID 101411672
dimethyl 3-methyl-4-[[(1S,2S,4R,5R)-3-tricyclo[3.2.1.02,4]octanyl]methyl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 101411672) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is dimethyl 3-methyl-4-[[(1S,2S,4R,5R)-3-tricyclo[3.2.1.02,4]octanyl]methyl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-methyl-4-[[(1S,2S,4R,5R)-3-tricyclo[3.2.1.02,4]octanyl]methyl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101411672 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | dimethyl 3-methyl-4-[[(1S,2S,4R,5R)-3-tricyclo[3.2.1.02,4]octanyl]methyl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C)=C(CC2[C@@H]3[C@H]4CC[C@H](C4)[C@H]23)C1 |
| InChI | InChI=1S/C19H26O4/c1-10-8-19(17(20)22-2,18(21)23-3)9-13(10)7-14-15-11-4-5-12(6-11)16(14)15/h11-12,14-16H,4-9H2,1-3H3/t11-,12+,14?,15-,16+ |
| InChIKey | QEFYGCTWORGSJU-QRYBQLHZSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|