C14H14O4 — CID 101411907
(1R,9R)-8,16-dioxatetracyclo[7.7.0.02,6.010,14]hexadeca-2,10-diene-4,12-dione (PubChem CID 101411907) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (1R,9R)-8,16-dioxatetracyclo[7.7.0.02,6.010,14]hexadeca-2,10-diene-4,12-dione.
| Compound Name | (1R,9R)-8,16-dioxatetracyclo[7.7.0.02,6.010,14]hexadeca-2,10-diene-4,12-dione |
|---|---|
| PubChem CID | 101411907 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (1R,9R)-8,16-dioxatetracyclo[7.7.0.02,6.010,14]hexadeca-2,10-diene-4,12-dione |
| SMILES | O=C1C=C2C(CO[C@@H]3C4=CC(=O)CC4CO[C@H]23)C1 |
| InChI | InChI=1S/C14H14O4/c15-9-1-7-5-17-14-12-4-10(16)2-8(12)6-18-13(14)11(7)3-9/h3-4,7-8,13-14H,1-2,5-6H2/t7?,8?,13-,14-/m1/s1 |
| InChIKey | DGZBNWDENBIXET-CDNKIBNWSA-N |
| XLogP | 0.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |